C11H16O4S — CID 107770104
5-(3-hydroxybutan-2-ylsulfanylmethyl)-2-methylfuran-3-carboxylic acid (PubChem CID 107770104) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 5-(3-hydroxybutan-2-ylsulfanylmethyl)-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-(3-hydroxybutan-2-ylsulfanylmethyl)-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 107770104 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-(3-hydroxybutan-2-ylsulfanylmethyl)-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CSC(C)C(C)O)cc1C(=O)O |
| InChI | InChI=1S/C11H16O4S/c1-6(12)8(3)16-5-9-4-10(11(13)14)7(2)15-9/h4,6,8,12H,5H2,1-3H3,(H,13,14) |
| InChIKey | UBTXFMRZXUCNBH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |