C13H11BrO3S — CID 43416917
5-[(4-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid (PubChem CID 43416917) has the molecular formula C13H11BrO3S and a molecular weight of 327.20 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(4-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 43416917 |
| Molecular Formula | C13H11BrO3S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 5-[(4-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CSc2ccc(Br)cc2)cc1C(=O)O |
| InChI | InChI=1S/C13H11BrO3S/c1-8-12(13(15)16)6-10(17-8)7-18-11-4-2-9(14)3-5-11/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | IYLBCQFQCIXWRX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |