C13H14BrN3O2S — CID 79533674
5-[(2-amino-5-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carbohydrazide (PubChem CID 79533674) has the molecular formula C13H14BrN3O2S and a molecular weight of 356.25 g/mol. Its IUPAC name is 5-[(2-amino-5-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | 5-[(2-amino-5-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 79533674 |
| Molecular Formula | C13H14BrN3O2S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 5-[(2-amino-5-bromophenyl)sulfanylmethyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1oc(CSc2cc(Br)ccc2N)cc1C(=O)NN |
| InChI | InChI=1S/C13H14BrN3O2S/c1-7-10(13(18)17-16)5-9(19-7)6-20-12-4-8(14)2-3-11(12)15/h2-5H,6,15-16H2,1H3,(H,17,18) |
| InChIKey | MDZGNFITXXOJDQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|