C15H16BrN3OS — CID 105352521
2-[4-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetohydrazide (PubChem CID 105352521) has the molecular formula C15H16BrN3OS and a molecular weight of 366.28 g/mol. Its IUPAC name is 2-[4-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetohydrazide.
| Compound Name | 2-[4-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 105352521 |
| Molecular Formula | C15H16BrN3OS |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2-[4-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetohydrazide |
| SMILES | NNC(=O)Cc1ccc(CSc2cc(Br)ccc2N)cc1 |
| InChI | InChI=1S/C15H16BrN3OS/c16-12-5-6-13(17)14(8-12)21-9-11-3-1-10(2-4-11)7-15(20)19-18/h1-6,8H,7,9,17-18H2,(H,19,20) |
| InChIKey | NLMCDJLGKBXWRY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|