C15H14BrNO2S — CID 115461031
2-[2-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetic acid (PubChem CID 115461031) has the molecular formula C15H14BrNO2S and a molecular weight of 352.25 g/mol. Its IUPAC name is 2-[2-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115461031 |
| Molecular Formula | C15H14BrNO2S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-[2-[(2-amino-5-bromophenyl)sulfanylmethyl]phenyl]acetic acid |
| SMILES | Nc1ccc(Br)cc1SCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C15H14BrNO2S/c16-12-5-6-13(17)14(8-12)20-9-11-4-2-1-3-10(11)7-15(18)19/h1-6,8H,7,9,17H2,(H,18,19) |
| InChIKey | JNXFVAFLQCQDRY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|