C13H14O4S — CID 135253629
2-methyl-5-[(5-methylfuran-2-yl)methylsulfanylmethyl]furan-3-carboxylic acid (PubChem CID 135253629) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-methyl-5-[(5-methylfuran-2-yl)methylsulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(5-methylfuran-2-yl)methylsulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 135253629 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-methyl-5-[(5-methylfuran-2-yl)methylsulfanylmethyl]furan-3-carboxylic acid |
| SMILES | Cc1ccc(CSCc2cc(C(=O)O)c(C)o2)o1 |
| InChI | InChI=1S/C13H14O4S/c1-8-3-4-10(16-8)6-18-7-11-5-12(13(14)15)9(2)17-11/h3-5H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | UDTUFPYMXXDCAC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |