C12H18O4S — CID 107753395
2-methyl-5-(3-methylbutylsulfinylmethyl)furan-3-carboxylic acid (PubChem CID 107753395) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-methyl-5-(3-methylbutylsulfinylmethyl)furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-(3-methylbutylsulfinylmethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 107753395 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-methyl-5-(3-methylbutylsulfinylmethyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(CS(=O)CCC(C)C)cc1C(=O)O |
| InChI | InChI=1S/C12H18O4S/c1-8(2)4-5-17(15)7-10-6-11(12(13)14)9(3)16-10/h6,8H,4-5,7H2,1-3H3,(H,13,14) |
| InChIKey | MYFHDSFWLPXDGO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |