C11H16O4S — CID 61302575
5-(butylsulfinylmethyl)-2-methylfuran-3-carboxylic acid (PubChem CID 61302575) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 5-(butylsulfinylmethyl)-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-(butylsulfinylmethyl)-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 61302575 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-(butylsulfinylmethyl)-2-methylfuran-3-carboxylic acid |
| SMILES | CCCCS(=O)Cc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C11H16O4S/c1-3-4-5-16(14)7-9-6-10(11(12)13)8(2)15-9/h6H,3-5,7H2,1-2H3,(H,12,13) |
| InChIKey | CREDSIIMORSGLY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |