C12H15FO3S — CID 66104988
5-fluoro-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]benzoic acid (PubChem CID 66104988) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-fluoro-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]benzoic acid.
| Compound Name | 5-fluoro-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 66104988 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-fluoro-2-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]benzoic acid |
| SMILES | CC(CO)CSCc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C12H15FO3S/c1-8(5-14)6-17-7-9-2-3-10(13)4-11(9)12(15)16/h2-4,8,14H,5-7H2,1H3,(H,15,16) |
| InChIKey | WALZAFGBJXVLKG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |