C12H16O3S2 — CID 77112725
3-[5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 77112725) has the molecular formula C12H16O3S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77112725 |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-[5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CC(CO)CSCc1cc(C=CC(=O)O)cs1 |
| InChI | InChI=1S/C12H16O3S2/c1-9(5-13)6-16-8-11-4-10(7-17-11)2-3-12(14)15/h2-4,7,9,13H,5-6,8H2,1H3,(H,14,15) |
| InChIKey | KEQAMPDTHXGXDN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|