C13H12O3S2 — CID 114000904
(E)-3-[5-[(2-methylfuran-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 114000904) has the molecular formula C13H12O3S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (E)-3-[5-[(2-methylfuran-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(2-methylfuran-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114000904 |
| Molecular Formula | C13H12O3S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | (E)-3-[5-[(2-methylfuran-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | Cc1occc1SCc1cc(/C=C/C(=O)O)cs1 |
| InChI | InChI=1S/C13H12O3S2/c1-9-12(4-5-16-9)18-8-11-6-10(7-17-11)2-3-13(14)15/h2-7H,8H2,1H3,(H,14,15)/b3-2+ |
| InChIKey | WFUFKCAFMWWURO-NSCUHMNNSA-N |
| XLogP | 4.04 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|