C12H11NO3S2 — CID 106924535
(E)-3-[5-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 106924535) has the molecular formula C12H11NO3S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (E)-3-[5-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106924535 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | (E)-3-[5-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | Cc1coc(SCc2cc(/C=C/C(=O)O)cs2)n1 |
| InChI | InChI=1S/C12H11NO3S2/c1-8-5-16-12(13-8)18-7-10-4-9(6-17-10)2-3-11(14)15/h2-6H,7H2,1H3,(H,14,15)/b3-2+ |
| InChIKey | IMCVKTQHBNJROP-NSCUHMNNSA-N |
| XLogP | 3.43 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|