C14H14N2O2S2 — CID 76938701
3-[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76938701) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76938701 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-[5-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | Cc1cc(C)nc(SCc2cc(C=CC(=O)O)cs2)n1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-9-5-10(2)16-14(15-9)20-8-12-6-11(7-19-12)3-4-13(17)18/h3-7H,8H2,1-2H3,(H,17,18) |
| InChIKey | SGGAZECCKFKPAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|