C14H11N3O2S2 — CID 76950775
3-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 76950775) has the molecular formula C14H11N3O2S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76950775 |
| Molecular Formula | C14H11N3O2S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(CSc2nnc3ccccn23)c1 |
| InChI | InChI=1S/C14H11N3O2S2/c18-13(19)5-4-10-7-11(20-8-10)9-21-14-16-15-12-3-1-2-6-17(12)14/h1-8H,9H2,(H,18,19) |
| InChIKey | PIGSJAOXPJQMQS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|