C15H14O3S2 — CID 76919013
3-[5-[(4-methoxyphenyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76919013) has the molecular formula C15H14O3S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[5-[(4-methoxyphenyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(4-methoxyphenyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76919013 |
| Molecular Formula | C15H14O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-[5-[(4-methoxyphenyl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | COc1ccc(SCc2cc(C=CC(=O)O)cs2)cc1 |
| InChI | InChI=1S/C15H14O3S2/c1-18-12-3-5-13(6-4-12)20-10-14-8-11(9-19-14)2-7-15(16)17/h2-9H,10H2,1H3,(H,16,17) |
| InChIKey | QKEONGGFAKQTSD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|