C15H16ClNO3 — CID 103244932
5-[[1-(4-chlorophenyl)ethylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 103244932) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is 5-[[1-(4-chlorophenyl)ethylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[1-(4-chlorophenyl)ethylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 103244932 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-[[1-(4-chlorophenyl)ethylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(C)c2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C15H16ClNO3/c1-9(11-3-5-12(16)6-4-11)17-8-13-7-14(15(18)19)10(2)20-13/h3-7,9,17H,8H2,1-2H3,(H,18,19) |
| InChIKey | YLCZTAUOCVNBOU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |