C15H13ClO2S — CID 113371633
2-chloro-5-[(3-methylphenyl)methylsulfanyl]benzoic acid (PubChem CID 113371633) has the molecular formula C15H13ClO2S and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-chloro-5-[(3-methylphenyl)methylsulfanyl]benzoic acid.
| Compound Name | 2-chloro-5-[(3-methylphenyl)methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 113371633 |
| Molecular Formula | C15H13ClO2S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-chloro-5-[(3-methylphenyl)methylsulfanyl]benzoic acid |
| SMILES | Cc1cccc(CSc2ccc(Cl)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C15H13ClO2S/c1-10-3-2-4-11(7-10)9-19-12-5-6-14(16)13(8-12)15(17)18/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | DWYDROAIRYYUPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |