C15H12F2O2S — CID 63537880
3,5-difluoro-4-[(3-methylphenyl)methylsulfanyl]benzoic acid (PubChem CID 63537880) has the molecular formula C15H12F2O2S and a molecular weight of 294.32 g/mol. Its IUPAC name is 3,5-difluoro-4-[(3-methylphenyl)methylsulfanyl]benzoic acid.
| Compound Name | 3,5-difluoro-4-[(3-methylphenyl)methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 63537880 |
| Molecular Formula | C15H12F2O2S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3,5-difluoro-4-[(3-methylphenyl)methylsulfanyl]benzoic acid |
| SMILES | Cc1cccc(CSc2c(F)cc(C(=O)O)cc2F)c1 |
| InChI | InChI=1S/C15H12F2O2S/c1-9-3-2-4-10(5-9)8-20-14-12(16)6-11(15(18)19)7-13(14)17/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | IUMFCKZUHJIEHJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |