C12H13ClO4S — CID 82365816
2-chloro-5-(3-ethoxy-3-oxopropyl)sulfanylbenzoic acid (PubChem CID 82365816) has the molecular formula C12H13ClO4S and a molecular weight of 288.75 g/mol. Its IUPAC name is 2-chloro-5-(3-ethoxy-3-oxopropyl)sulfanylbenzoic acid.
| Compound Name | 2-chloro-5-(3-ethoxy-3-oxopropyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 82365816 |
| Molecular Formula | C12H13ClO4S |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-chloro-5-(3-ethoxy-3-oxopropyl)sulfanylbenzoic acid |
| SMILES | CCOC(=O)CCSc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H13ClO4S/c1-2-17-11(14)5-6-18-8-3-4-10(13)9(7-8)12(15)16/h3-4,7H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | FJEFVHZMSPDOFX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |