C11H16N2O2S — CID 66337335
hydrazinyl 3-(3,4-dimethylphenyl)sulfanylpropanoate (PubChem CID 66337335) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is hydrazinyl 3-(3,4-dimethylphenyl)sulfanylpropanoate.
| Compound Name | hydrazinyl 3-(3,4-dimethylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 66337335 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | hydrazinyl 3-(3,4-dimethylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)ONN)cc1C |
| InChI | InChI=1S/C11H16N2O2S/c1-8-3-4-10(7-9(8)2)16-6-5-11(14)15-13-12/h3-4,7,13H,5-6,12H2,1-2H3 |
| InChIKey | HCMDXPKLAWFYMZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|