C17H26N2OS — CID 119477664
N-(4-aminocyclohexyl)-3-(3,4-dimethylphenyl)sulfanylpropanamide (PubChem CID 119477664) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-(3,4-dimethylphenyl)sulfanylpropanamide.
| Compound Name | N-(4-aminocyclohexyl)-3-(3,4-dimethylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 119477664 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-(3,4-dimethylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(SCCC(=O)NC2CCC(N)CC2)cc1C |
| InChI | InChI=1S/C17H26N2OS/c1-12-3-8-16(11-13(12)2)21-10-9-17(20)19-15-6-4-14(18)5-7-15/h3,8,11,14-15H,4-7,9-10,18H2,1-2H3,(H,19,20) |
| InChIKey | QYDNNQCPUMCPKC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |