C16H22N2O2S — CID 62490585
3-(3,4-dimethylphenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide (PubChem CID 62490585) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 62490585 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide |
| SMILES | Cc1ccc(SCCC(=O)NC2CCC(=O)NC2)cc1C |
| InChI | InChI=1S/C16H22N2O2S/c1-11-3-5-14(9-12(11)2)21-8-7-16(20)18-13-4-6-15(19)17-10-13/h3,5,9,13H,4,6-8,10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | ONIQXCCJHKDXLR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |