C14H16F2N2O2S — CID 62896998
3-(3,4-difluorophenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide (PubChem CID 62896998) has the molecular formula C14H16F2N2O2S and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide.
| Compound Name | 3-(3,4-difluorophenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 62896998 |
| Molecular Formula | C14H16F2N2O2S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanyl-N-(6-oxopiperidin-3-yl)propanamide |
| SMILES | O=C1CCC(NC(=O)CCSc2ccc(F)c(F)c2)CN1 |
| InChI | InChI=1S/C14H16F2N2O2S/c15-11-3-2-10(7-12(11)16)21-6-5-14(20)18-9-1-4-13(19)17-8-9/h2-3,7,9H,1,4-6,8H2,(H,17,19)(H,18,20) |
| InChIKey | YTICSIPXXUAQBH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |