C19H27N3O2S — CID 55922942
N-cyclopropyl-2-[4-[2-(3,4-dimethylphenyl)sulfanylethyl]piperazin-1-yl]-2-oxoacetamide (PubChem CID 55922942) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-(3,4-dimethylphenyl)sulfanylethyl]piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-(3,4-dimethylphenyl)sulfanylethyl]piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 55922942 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-(3,4-dimethylphenyl)sulfanylethyl]piperazin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(SCCN2CCN(C(=O)C(=O)NC3CC3)CC2)cc1C |
| InChI | InChI=1S/C19H27N3O2S/c1-14-3-6-17(13-15(14)2)25-12-11-21-7-9-22(10-8-21)19(24)18(23)20-16-4-5-16/h3,6,13,16H,4-5,7-12H2,1-2H3,(H,20,23) |
| InChIKey | NIRYMGUFNDKDDL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|