C18H24FN3O2 — CID 99857032
N-cyclopropyl-2-[4-[(2R)-2-(4-fluorophenyl)propyl]piperazin-1-yl]-2-oxoacetamide (PubChem CID 99857032) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[(2R)-2-(4-fluorophenyl)propyl]piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[4-[(2R)-2-(4-fluorophenyl)propyl]piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 99857032 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-cyclopropyl-2-[4-[(2R)-2-(4-fluorophenyl)propyl]piperazin-1-yl]-2-oxoacetamide |
| SMILES | C[C@@H](CN1CCN(C(=O)C(=O)NC2CC2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3O2/c1-13(14-2-4-15(19)5-3-14)12-21-8-10-22(11-9-21)18(24)17(23)20-16-6-7-16/h2-5,13,16H,6-12H2,1H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | DOMDLHNPTUNPCT-ZDUSSCGKSA-N |
| XLogP | 1.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|