C14H19Cl2NOS — CID 1486391
2-(3,4-dichlorophenyl)sulfanyl-N,N-di(propan-2-yl)acetamide (PubChem CID 1486391) has the molecular formula C14H19Cl2NOS and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfanyl-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)sulfanyl-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 1486391 |
| Molecular Formula | C14H19Cl2NOS |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfanyl-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)CSc1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C14H19Cl2NOS/c1-9(2)17(10(3)4)14(18)8-19-11-5-6-12(15)13(16)7-11/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | XNGDFVOQRVIANT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |