C13H15NOS — CID 26579620
2-(3,4-dimethylphenyl)sulfanyl-N-prop-2-ynylacetamide (PubChem CID 26579620) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-N-prop-2-ynylacetamide.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 26579620 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H15NOS/c1-4-7-14-13(15)9-16-12-6-5-10(2)11(3)8-12/h1,5-6,8H,7,9H2,2-3H3,(H,14,15) |
| InChIKey | LHKNKQZJTPOQNE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|