C12H14N2OS — CID 66353280
2-[3-(aminomethyl)phenyl]sulfanyl-N-prop-2-ynylacetamide (PubChem CID 66353280) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]sulfanyl-N-prop-2-ynylacetamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]sulfanyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 66353280 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]sulfanyl-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1cccc(CN)c1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-6-14-12(15)9-16-11-5-3-4-10(7-11)8-13/h1,3-5,7H,6,8-9,13H2,(H,14,15) |
| InChIKey | MNQOMSWBCAPSMP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|