C11H11FN2OS — CID 79141742
2-(4-amino-3-fluorophenyl)sulfanyl-N-prop-2-ynylacetamide (PubChem CID 79141742) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(4-amino-3-fluorophenyl)sulfanyl-N-prop-2-ynylacetamide.
| Compound Name | 2-(4-amino-3-fluorophenyl)sulfanyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 79141742 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(4-amino-3-fluorophenyl)sulfanyl-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C11H11FN2OS/c1-2-5-14-11(15)7-16-8-3-4-10(13)9(12)6-8/h1,3-4,6H,5,7,13H2,(H,14,15) |
| InChIKey | VNLXUZAZOCMXBS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|