C10H9FN2O — CID 62678151
4-amino-3-fluoro-N-prop-2-ynylbenzamide (PubChem CID 62678151) has the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-prop-2-ynylbenzamide.
| Compound Name | 4-amino-3-fluoro-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 62678151 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-amino-3-fluoro-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C10H9FN2O/c1-2-5-13-10(14)7-3-4-9(12)8(11)6-7/h1,3-4,6H,5,12H2,(H,13,14) |
| InChIKey | WCASFXUWACKCRF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|