C15H22N2OS — CID 9271687
2-(3,4-dimethylphenyl)sulfanyl-N-piperidin-1-ylacetamide (PubChem CID 9271687) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-N-piperidin-1-ylacetamide.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-N-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 9271687 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-N-piperidin-1-ylacetamide |
| SMILES | Cc1ccc(SCC(=O)NN2CCCCC2)cc1C |
| InChI | InChI=1S/C15H22N2OS/c1-12-6-7-14(10-13(12)2)19-11-15(18)16-17-8-4-3-5-9-17/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,16,18) |
| InChIKey | QCUNGESUTCWZSC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |