C20H30N2O2S — CID 78791575
3-(3,4-dimethylphenyl)sulfanyl-N-[3-(2-oxoazepan-1-yl)propyl]propanamide (PubChem CID 78791575) has the molecular formula C20H30N2O2S and a molecular weight of 362.54 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfanyl-N-[3-(2-oxoazepan-1-yl)propyl]propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)sulfanyl-N-[3-(2-oxoazepan-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 78791575 |
| Molecular Formula | C20H30N2O2S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfanyl-N-[3-(2-oxoazepan-1-yl)propyl]propanamide |
| SMILES | Cc1ccc(SCCC(=O)NCCCN2CCCCCC2=O)cc1C |
| InChI | InChI=1S/C20H30N2O2S/c1-16-8-9-18(15-17(16)2)25-14-10-19(23)21-11-6-13-22-12-5-3-4-7-20(22)24/h8-9,15H,3-7,10-14H2,1-2H3,(H,21,23) |
| InChIKey | QVYKMCZSKDGRRE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|