C17H24N2O2S — CID 35499280
2-(2,5-dimethylphenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 35499280) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 35499280 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | Cc1ccc(C)c(SCC(=O)NCCCN2CCCC2=O)c1 |
| InChI | InChI=1S/C17H24N2O2S/c1-13-6-7-14(2)15(11-13)22-12-16(20)18-8-4-10-19-9-3-5-17(19)21/h6-7,11H,3-5,8-10,12H2,1-2H3,(H,18,20) |
| InChIKey | SDEZGKKULJSDLN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|