C18H27N3O3S — CID 99171268
N-[4-oxo-4-[3-(2-oxoazepan-1-yl)propylamino]butyl]thiophene-3-carboxamide (PubChem CID 99171268) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[4-oxo-4-[3-(2-oxoazepan-1-yl)propylamino]butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-[3-(2-oxoazepan-1-yl)propylamino]butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 99171268 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[4-oxo-4-[3-(2-oxoazepan-1-yl)propylamino]butyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C18H27N3O3S/c22-16(6-4-9-20-18(24)15-8-13-25-14-15)19-10-5-12-21-11-3-1-2-7-17(21)23/h8,13-14H,1-7,9-12H2,(H,19,22)(H,20,24) |
| InChIKey | QVOGLUUBOWSRCN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|