C18H29N3O2S — CID 35417013
N-[4-[3-(4-methylpiperidin-1-yl)propylamino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 35417013) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-[4-[3-(4-methylpiperidin-1-yl)propylamino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[3-(4-methylpiperidin-1-yl)propylamino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 35417013 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[4-[3-(4-methylpiperidin-1-yl)propylamino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)CCCNC(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C18H29N3O2S/c1-15-5-11-21(12-6-15)10-3-9-19-17(22)4-2-8-20-18(23)16-7-13-24-14-16/h7,13-15H,2-6,8-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | AJGBRUIMTMRIAA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|