C15H23N3O4S2 — CID 47909584
N-[4-[(1-methylsulfonylpiperidin-3-yl)amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 47909584) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[4-[(1-methylsulfonylpiperidin-3-yl)amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[(1-methylsulfonylpiperidin-3-yl)amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 47909584 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[4-[(1-methylsulfonylpiperidin-3-yl)amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)CCCNC(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-24(21,22)18-8-3-4-13(10-18)17-14(19)5-2-7-16-15(20)12-6-9-23-11-12/h6,9,11,13H,2-5,7-8,10H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | NLAJMPDHMSWTQQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|