C13H21N3O3S2 — CID 96581050
N-[(3R)-1-(dimethylsulfamoyl)azepan-3-yl]thiophene-3-carboxamide (PubChem CID 96581050) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[(3R)-1-(dimethylsulfamoyl)azepan-3-yl]thiophene-3-carboxamide.
| Compound Name | N-[(3R)-1-(dimethylsulfamoyl)azepan-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 96581050 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[(3R)-1-(dimethylsulfamoyl)azepan-3-yl]thiophene-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC[C@@H](NC(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C13H21N3O3S2/c1-15(2)21(18,19)16-7-4-3-5-12(9-16)14-13(17)11-6-8-20-10-11/h6,8,10,12H,3-5,7,9H2,1-2H3,(H,14,17)/t12-/m1/s1 |
| InChIKey | OISDGIHXRCHSKY-GFCCVEGCSA-N |
| XLogP | 1.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |