C14H29N3O2S — CID 96579953
(3R)-3-(cyclohexylamino)-N,N-dimethylazepane-1-sulfonamide (PubChem CID 96579953) has the molecular formula C14H29N3O2S and a molecular weight of 303.47 g/mol. Its IUPAC name is (3R)-3-(cyclohexylamino)-N,N-dimethylazepane-1-sulfonamide.
| Compound Name | (3R)-3-(cyclohexylamino)-N,N-dimethylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 96579953 |
| Molecular Formula | C14H29N3O2S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (3R)-3-(cyclohexylamino)-N,N-dimethylazepane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC[C@@H](NC2CCCCC2)C1 |
| InChI | InChI=1S/C14H29N3O2S/c1-16(2)20(18,19)17-11-7-6-10-14(12-17)15-13-8-4-3-5-9-13/h13-15H,3-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | NPBBXQFNFBDAPE-CQSZACIVSA-N |
| XLogP | 1.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |