C8H17ClN2O2S — CID 131107442
4-chloro-N,N-dimethylazepane-1-sulfonamide (PubChem CID 131107442) has the molecular formula C8H17ClN2O2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 4-chloro-N,N-dimethylazepane-1-sulfonamide.
| Compound Name | 4-chloro-N,N-dimethylazepane-1-sulfonamide |
|---|---|
| PubChem CID | 131107442 |
| Molecular Formula | C8H17ClN2O2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-chloro-N,N-dimethylazepane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(Cl)CC1 |
| InChI | InChI=1S/C8H17ClN2O2S/c1-10(2)14(12,13)11-6-3-4-8(9)5-7-11/h8H,3-7H2,1-2H3 |
| InChIKey | KPNGKJMYZDKTGW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|