C8H16N2O3S — CID 63845899
3-formyl-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 63845899) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-formyl-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | 3-formyl-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 63845899 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-formyl-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C=O)C1 |
| InChI | InChI=1S/C8H16N2O3S/c1-9(2)14(12,13)10-5-3-4-8(6-10)7-11/h7-8H,3-6H2,1-2H3 |
| InChIKey | SVWJNHSDCKBDRE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|