C21H26FN3O2S — CID 86965265
N-[4-[[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 86965265) has the molecular formula C21H26FN3O2S and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[4-[[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 86965265 |
| Molecular Formula | C21H26FN3O2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[4-[[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | Cc1ccc(F)c(N2CCCC(NC(=O)CCCNC(=O)c3ccsc3)C2)c1 |
| InChI | InChI=1S/C21H26FN3O2S/c1-15-6-7-18(22)19(12-15)25-10-3-4-17(13-25)24-20(26)5-2-9-23-21(27)16-8-11-28-14-16/h6-8,11-12,14,17H,2-5,9-10,13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | OKUKDISACHIEBH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|