C23H30FN3O3 — CID 86965296
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]propanamide (PubChem CID 86965296) has the molecular formula C23H30FN3O3 and a molecular weight of 415.51 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 86965296 |
| Molecular Formula | C23H30FN3O3 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]propanamide |
| SMILES | Cc1ccc(F)c(N2CCCC(NC(=O)CCN3C(=O)C4CCCCC4C3=O)C2)c1 |
| InChI | InChI=1S/C23H30FN3O3/c1-15-8-9-19(24)20(13-15)26-11-4-5-16(14-26)25-21(28)10-12-27-22(29)17-6-2-3-7-18(17)23(27)30/h8-9,13,16-18H,2-7,10-12,14H2,1H3,(H,25,28) |
| InChIKey | GLDFSKDBVGQJEX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|