C21H33FN4O3S — CID 86966897
1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-(1-propylsulfonylpiperidin-4-yl)urea (PubChem CID 86966897) has the molecular formula C21H33FN4O3S and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-(1-propylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-(1-propylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 86966897 |
| Molecular Formula | C21H33FN4O3S |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-(1-propylsulfonylpiperidin-4-yl)urea |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=O)NC2CCCN(c3cc(C)ccc3F)C2)CC1 |
| InChI | InChI=1S/C21H33FN4O3S/c1-3-13-30(28,29)26-11-8-17(9-12-26)23-21(27)24-18-5-4-10-25(15-18)20-14-16(2)6-7-19(20)22/h6-7,14,17-18H,3-5,8-13,15H2,1-2H3,(H2,23,24,27) |
| InChIKey | MZBGHBFDWNYBBS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |