C18H28FN3O2 — CID 97069908
3-[(3S)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-1-[(3R)-3-hydroxybutyl]-1-methylurea (PubChem CID 97069908) has the molecular formula C18H28FN3O2 and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-[(3S)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-1-[(3R)-3-hydroxybutyl]-1-methylurea.
| Compound Name | 3-[(3S)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-1-[(3R)-3-hydroxybutyl]-1-methylurea |
|---|---|
| PubChem CID | 97069908 |
| Molecular Formula | C18H28FN3O2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 3-[(3S)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-1-[(3R)-3-hydroxybutyl]-1-methylurea |
| SMILES | Cc1ccc(F)c(N2CCC[C@H](NC(=O)N(C)CC[C@@H](C)O)C2)c1 |
| InChI | InChI=1S/C18H28FN3O2/c1-13-6-7-16(19)17(11-13)22-9-4-5-15(12-22)20-18(24)21(3)10-8-14(2)23/h6-7,11,14-15,23H,4-5,8-10,12H2,1-3H3,(H,20,24)/t14-,15+/m1/s1 |
| InChIKey | RGVJETPCFRQYHF-CABCVRRESA-N |
| XLogP | 2.52 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |