C19H19F3N2O — CID 86965224
2,5-difluoro-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]benzamide (PubChem CID 86965224) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is 2,5-difluoro-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]benzamide.
| Compound Name | 2,5-difluoro-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 86965224 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,5-difluoro-N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]benzamide |
| SMILES | Cc1ccc(F)c(N2CCCC(NC(=O)c3cc(F)ccc3F)C2)c1 |
| InChI | InChI=1S/C19H19F3N2O/c1-12-4-6-17(22)18(9-12)24-8-2-3-14(11-24)23-19(25)15-10-13(20)5-7-16(15)21/h4-7,9-10,14H,2-3,8,11H2,1H3,(H,23,25) |
| InChIKey | SPQUUZJLWLJFIS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |