C22H26FN3O3 — CID 86967206
N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-hydroxy-5-(propanoylamino)benzamide (PubChem CID 86967206) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-hydroxy-5-(propanoylamino)benzamide.
| Compound Name | N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-hydroxy-5-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 86967206 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-2-hydroxy-5-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(O)c(C(=O)NC2CCCN(c3cc(C)ccc3F)C2)c1 |
| InChI | InChI=1S/C22H26FN3O3/c1-3-21(28)24-15-7-9-20(27)17(12-15)22(29)25-16-5-4-10-26(13-16)19-11-14(2)6-8-18(19)23/h6-9,11-12,16,27H,3-5,10,13H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | NQQOOEPHENRYIZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|