C17H23FN2O2S — CID 97330646
(3R)-N-[(3R)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-hydroxythiolane-3-carboxamide (PubChem CID 97330646) has the molecular formula C17H23FN2O2S and a molecular weight of 338.45 g/mol. Its IUPAC name is (3R)-N-[(3R)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-hydroxythiolane-3-carboxamide.
| Compound Name | (3R)-N-[(3R)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-hydroxythiolane-3-carboxamide |
|---|---|
| PubChem CID | 97330646 |
| Molecular Formula | C17H23FN2O2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (3R)-N-[(3R)-1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-hydroxythiolane-3-carboxamide |
| SMILES | Cc1ccc(F)c(N2CCC[C@@H](NC(=O)[C@]3(O)CCSC3)C2)c1 |
| InChI | InChI=1S/C17H23FN2O2S/c1-12-4-5-14(18)15(9-12)20-7-2-3-13(10-20)19-16(21)17(22)6-8-23-11-17/h4-5,9,13,22H,2-3,6-8,10-11H2,1H3,(H,19,21)/t13-,17+/m1/s1 |
| InChIKey | QUMBTHJEKJQXJB-DYVFJYSZSA-N |
| XLogP | 2.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |