C21H26FN3O2 — CID 86967320
1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea (PubChem CID 86967320) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea.
| Compound Name | 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86967320 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-[1-(2-fluoro-5-methylphenyl)piperidin-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea |
| SMILES | Cc1ccc(F)c(N2CCCC(NC(=O)NCCc3cccc(O)c3)C2)c1 |
| InChI | InChI=1S/C21H26FN3O2/c1-15-7-8-19(22)20(12-15)25-11-3-5-17(14-25)24-21(27)23-10-9-16-4-2-6-18(26)13-16/h2,4,6-8,12-13,17,26H,3,5,9-11,14H2,1H3,(H2,23,24,27) |
| InChIKey | BKUBYEAHFXSJOV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |