C17H16ClN3O4S — CID 59704653
3-(2-chloro-4-methylsulfanylanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide (PubChem CID 59704653) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is 3-(2-chloro-4-methylsulfanylanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-(2-chloro-4-methylsulfanylanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59704653 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-(2-chloro-4-methylsulfanylanilino)-N-(2-hydroxyethoxy)furo[3,2-c]pyridine-2-carboxamide |
| SMILES | CSc1ccc(Nc2c(C(=O)NOCCO)oc3ccncc23)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O4S/c1-26-10-2-3-13(12(18)8-10)20-15-11-9-19-5-4-14(11)25-16(15)17(23)21-24-7-6-22/h2-5,8-9,20,22H,6-7H2,1H3,(H,21,23) |
| InChIKey | CIPLOZAHIPJKFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|