C16H16BrFN2O4 — CID 58368273
2-[(4-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyethoxy)-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 58368273) has the molecular formula C16H16BrFN2O4 and a molecular weight of 399.22 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyethoxy)-1-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyethoxy)-1-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 58368273 |
| Molecular Formula | C16H16BrFN2O4 |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyethoxy)-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | Cn1c(Cc2ccc(Br)cc2F)c(C(=O)NOCCO)ccc1=O |
| InChI | InChI=1S/C16H16BrFN2O4/c1-20-14(8-10-2-3-11(17)9-13(10)18)12(4-5-15(20)22)16(23)19-24-7-6-21/h2-5,9,21H,6-8H2,1H3,(H,19,23) |
| InChIKey | ZUUDWOUOUYFAJA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|